C16H22F8O4 — CID 152654240
4,4,5,5,6,6,7,7-octafluoro-1,10-bis(prop-1-enoxy)decane-2,9-diol (PubChem CID 152654240) has the molecular formula C16H22F8O4 and a molecular weight of 430.33 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7-octafluoro-1,10-bis(prop-1-enoxy)decane-2,9-diol.
| Compound Name | 4,4,5,5,6,6,7,7-octafluoro-1,10-bis(prop-1-enoxy)decane-2,9-diol |
|---|---|
| PubChem CID | 152654240 |
| Molecular Formula | C16H22F8O4 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 4,4,5,5,6,6,7,7-octafluoro-1,10-bis(prop-1-enoxy)decane-2,9-diol |
| SMILES | CC=COCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(O)COC=CC |
| InChI | InChI=1S/C16H22F8O4/c1-3-5-27-9-11(25)7-13(17,18)15(21,22)16(23,24)14(19,20)8-12(26)10-28-6-4-2/h3-6,11-12,25-26H,7-10H2,1-2H3 |
| InChIKey | ZIENHWYONKZRAC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|