C9H12F9NO — CID 138396345
1-(dimethylamino)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol (PubChem CID 138396345) has the molecular formula C9H12F9NO and a molecular weight of 321.18 g/mol. Its IUPAC name is 1-(dimethylamino)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol.
| Compound Name | 1-(dimethylamino)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol |
|---|---|
| PubChem CID | 138396345 |
| Molecular Formula | C9H12F9NO |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-(dimethylamino)-4,4,5,5,6,6,7,7,7-nonafluoroheptan-2-ol |
| SMILES | CN(C)CC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F9NO/c1-19(2)4-5(20)3-6(10,11)7(12,13)8(14,15)9(16,17)18/h5,20H,3-4H2,1-2H3 |
| InChIKey | LSUAQOJEEKKGRB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|