C12H16F13N2O3+ — CID 102295547
azanium 2-[methyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)amino]acetic acid (PubChem CID 102295547) has the molecular formula C12H16F13N2O3+ and a molecular weight of 483.25 g/mol. Its IUPAC name is azanium 2-[methyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)amino]acetic acid.
| Compound Name | azanium 2-[methyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)amino]acetic acid |
|---|---|
| PubChem CID | 102295547 |
| Molecular Formula | C12H16F13N2O3+ |
| Molecular Weight | 483.25 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | azanium 2-[methyl-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)amino]acetic acid |
| SMILES | CN(CC(=O)O)CC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[NH4+] |
| InChI | InChI=1S/C12H12F13NO3.H3N/c1-26(4-6(28)29)3-5(27)2-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25;/h5,27H,2-4H2,1H3,(H,28,29);1H3/p+1 |
| InChIKey | OVGPSQSDKOCGIY-UHFFFAOYSA-O |
| XLogP | 3.87 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|