2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid

C10H21NO4 — CID 175832916

IUPAC2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid
SMILESCCC(O)CC[C@@H](O)CN(C)CC(=O)O
InChIInChI=1S/C10H21NO4/c1-3-8(12)4-5-9(13)6-11(2)7-10(14)15/h8-9,12-13H,3-7H2,1-2H3,(H,14,15)/t8?,9-/m1/s1
InChIKeyIZZYUNOIPCYBBH-YGPZHTELSA-N
MW219.28 g/mol
LogP-0.09
Rot. Bonds8

About 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid

2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid (PubChem CID 175832916) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid.

Molecular Properties

Compound Name2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid
PubChem CID175832916
Molecular FormulaC10H21NO4
Molecular Weight219.28 g/mol
Exact Mass219.15
IUPAC Name2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid
SMILESCCC(O)CC[C@@H](O)CN(C)CC(=O)O
InChIInChI=1S/C10H21NO4/c1-3-8(12)4-5-9(13)6-11(2)7-10(14)15/h8-9,12-13H,3-7H2,1-2H3,(H,14,15)/t8?,9-/m1/s1
InChIKeyIZZYUNOIPCYBBH-YGPZHTELSA-N
XLogP-0.09
TPSA81.00 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.28
LogP ≤ 5-0.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid?
The IUPAC name of 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid (CID 175832916) is 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid.
What is the SMILES notation for 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid?
The canonical SMILES for 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid is CCC(O)CC[C@@H](O)CN(C)CC(=O)O.
What is the InChIKey of 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid?
The InChIKey is IZZYUNOIPCYBBH-YGPZHTELSA-N. The full InChI is InChI=1S/C10H21NO4/c1-3-8(12)4-5-9(13)6-11(2)7-10(14)15/h8-9,12-13H,3-7H2,1-2H3,(H,14,15)/t8?,9-/m1/s1.
What are the key properties of 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid?
2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid has a molecular weight of 219.28 g/mol, XLogP of -0.09, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid is sourced from PubChem (CID 175832916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).