C10H21NO4 — CID 175832916
2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid (PubChem CID 175832916) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid.
| Compound Name | 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 175832916 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-[[(2R)-2,5-dihydroxyheptyl]-methylamino]acetic acid |
| SMILES | CCC(O)CC[C@@H](O)CN(C)CC(=O)O |
| InChI | InChI=1S/C10H21NO4/c1-3-8(12)4-5-9(13)6-11(2)7-10(14)15/h8-9,12-13H,3-7H2,1-2H3,(H,14,15)/t8?,9-/m1/s1 |
| InChIKey | IZZYUNOIPCYBBH-YGPZHTELSA-N |
| XLogP | -0.09 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |