C13H21NO8 — CID 159990422
2-[2-[bis(carboxymethyl)amino]-2-oxoethyl]-5-hydroxyheptanoic acid (PubChem CID 159990422) has the molecular formula C13H21NO8 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]-2-oxoethyl]-5-hydroxyheptanoic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]-2-oxoethyl]-5-hydroxyheptanoic acid |
|---|---|
| PubChem CID | 159990422 |
| Molecular Formula | C13H21NO8 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]-2-oxoethyl]-5-hydroxyheptanoic acid |
| SMILES | CCC(O)CCC(CC(=O)N(CC(=O)O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H21NO8/c1-2-9(15)4-3-8(13(21)22)5-10(16)14(6-11(17)18)7-12(19)20/h8-9,15H,2-7H2,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | GEXQKEMTMYXANE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |