C30H20F38O6 — CID 101279924
bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-nonadecafluoro-2-hydroxydodecyl) hexanedioate (PubChem CID 101279924) has the molecular formula C30H20F38O6 and a molecular weight of 1198.41 g/mol. Its IUPAC name is bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-nonadecafluoro-2-hydroxydodecyl) hexanedioate.
| Compound Name | bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-nonadecafluoro-2-hydroxydodecyl) hexanedioate |
|---|---|
| PubChem CID | 101279924 |
| Molecular Formula | C30H20F38O6 |
| Molecular Weight | 1198.41 g/mol |
| Exact Mass | 1198.07 |
| IUPAC Name | bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-nonadecafluoro-2-hydroxydodecyl) hexanedioate |
| SMILES | O=C(CCCCC(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H20F38O6/c31-13(32,15(35,36)17(39,40)19(43,44)21(47,48)23(51,52)25(55,56)27(59,60)29(63,64)65)5-9(69)7-73-11(71)3-1-2-4-12(72)74-8-10(70)6-14(33,34)16(37,38)18(41,42)20(45,46)22(49,50)24(53,54)26(57,58)28(61,62)30(66,67)68/h9-10,69-70H,1-8H2 |
| InChIKey | KXXQAXHRCDMJIP-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1198.41 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|