C6H11ClO3 — CID 174905272
3-(3-chloroprop-1-enoxy)propane-1,2-diol (PubChem CID 174905272) has the molecular formula C6H11ClO3 and a molecular weight of 166.60 g/mol. Its IUPAC name is 3-(3-chloroprop-1-enoxy)propane-1,2-diol.
| Compound Name | 3-(3-chloroprop-1-enoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 174905272 |
| Molecular Formula | C6H11ClO3 |
| Molecular Weight | 166.60 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | 3-(3-chloroprop-1-enoxy)propane-1,2-diol |
| SMILES | OCC(O)COC=CCCl |
| InChI | InChI=1S/C6H11ClO3/c7-2-1-3-10-5-6(9)4-8/h1,3,6,8-9H,2,4-5H2 |
| InChIKey | HAZUABOHJDLGQF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.60 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|