C5H8Cl2O3 — CID 119096615
(2S)-3-[(Z)-1,2-dichloroethenoxy]propane-1,2-diol (PubChem CID 119096615) has the molecular formula C5H8Cl2O3 and a molecular weight of 187.02 g/mol. Its IUPAC name is (2S)-3-[(Z)-1,2-dichloroethenoxy]propane-1,2-diol.
| Compound Name | (2S)-3-[(Z)-1,2-dichloroethenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 119096615 |
| Molecular Formula | C5H8Cl2O3 |
| Molecular Weight | 187.02 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | (2S)-3-[(Z)-1,2-dichloroethenoxy]propane-1,2-diol |
| SMILES | OC[C@H](O)CO/C(Cl)=C/Cl |
| InChI | InChI=1S/C5H8Cl2O3/c6-1-5(7)10-3-4(9)2-8/h1,4,8-9H,2-3H2/b5-1+/t4-/m0/s1 |
| InChIKey | LLKACYCWAPYGAT-BBUKGYLASA-N |
| XLogP | 0.63 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.02 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|