C11H22O6 — CID 148547128
3-[3-(2,3-dihydroxypropoxy)pent-3-enoxy]propane-1,2-diol (PubChem CID 148547128) has the molecular formula C11H22O6 and a molecular weight of 250.29 g/mol. Its IUPAC name is 3-[3-(2,3-dihydroxypropoxy)pent-3-enoxy]propane-1,2-diol.
| Compound Name | 3-[3-(2,3-dihydroxypropoxy)pent-3-enoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 148547128 |
| Molecular Formula | C11H22O6 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-[3-(2,3-dihydroxypropoxy)pent-3-enoxy]propane-1,2-diol |
| SMILES | CC=C(CCOCC(O)CO)OCC(O)CO |
| InChI | InChI=1S/C11H22O6/c1-2-11(17-8-10(15)6-13)3-4-16-7-9(14)5-12/h2,9-10,12-15H,3-8H2,1H3 |
| InChIKey | MWCQEIGSJLYNFH-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|