C6H13NO5 — CID 141007752
3-(2,3-dihydroxypropoxy)-N-hydroxypropanamide (PubChem CID 141007752) has the molecular formula C6H13NO5 and a molecular weight of 179.17 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropoxy)-N-hydroxypropanamide.
| Compound Name | 3-(2,3-dihydroxypropoxy)-N-hydroxypropanamide |
|---|---|
| PubChem CID | 141007752 |
| Molecular Formula | C6H13NO5 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 3-(2,3-dihydroxypropoxy)-N-hydroxypropanamide |
| SMILES | O=C(CCOCC(O)CO)NO |
| InChI | InChI=1S/C6H13NO5/c8-3-5(9)4-12-2-1-6(10)7-11/h5,8-9,11H,1-4H2,(H,7,10) |
| InChIKey | XSXQYVVNJTVUSV-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|