C11H22INO6 — CID 134581672
3-[2-[2-(2-hydroxy-3-methoxypropoxy)ethoxy]ethoxy]-N-iodopropanamide (PubChem CID 134581672) has the molecular formula C11H22INO6 and a molecular weight of 391.20 g/mol. Its IUPAC name is 3-[2-[2-(2-hydroxy-3-methoxypropoxy)ethoxy]ethoxy]-N-iodopropanamide.
| Compound Name | 3-[2-[2-(2-hydroxy-3-methoxypropoxy)ethoxy]ethoxy]-N-iodopropanamide |
|---|---|
| PubChem CID | 134581672 |
| Molecular Formula | C11H22INO6 |
| Molecular Weight | 391.20 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 3-[2-[2-(2-hydroxy-3-methoxypropoxy)ethoxy]ethoxy]-N-iodopropanamide |
| SMILES | COCC(O)COCCOCCOCCC(=O)NI |
| InChI | InChI=1S/C11H22INO6/c1-16-8-10(14)9-19-7-6-18-5-4-17-3-2-11(15)13-12/h10,14H,2-9H2,1H3,(H,13,15) |
| InChIKey | TYXUKNNWIXDTCO-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|