C10H22O8 — CID 174669486
3-[4-(2,3-dihydroxypropylperoxy)butylperoxy]propane-1,2-diol (PubChem CID 174669486) has the molecular formula C10H22O8 and a molecular weight of 270.28 g/mol. Its IUPAC name is 3-[4-(2,3-dihydroxypropylperoxy)butylperoxy]propane-1,2-diol.
| Compound Name | 3-[4-(2,3-dihydroxypropylperoxy)butylperoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 174669486 |
| Molecular Formula | C10H22O8 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 3-[4-(2,3-dihydroxypropylperoxy)butylperoxy]propane-1,2-diol |
| SMILES | OCC(O)COOCCCCOOCC(O)CO |
| InChI | InChI=1S/C10H22O8/c11-5-9(13)7-17-15-3-1-2-4-16-18-8-10(14)6-12/h9-14H,1-8H2 |
| InChIKey | OKEMHMVJLLUDPY-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|