C7H15NO4 — CID 130438480
N-[(2R)-2,3-dihydroxypropoxy]-2-methylpropanamide (PubChem CID 130438480) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is N-[(2R)-2,3-dihydroxypropoxy]-2-methylpropanamide.
| Compound Name | N-[(2R)-2,3-dihydroxypropoxy]-2-methylpropanamide |
|---|---|
| PubChem CID | 130438480 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | N-[(2R)-2,3-dihydroxypropoxy]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NOC[C@H](O)CO |
| InChI | InChI=1S/C7H15NO4/c1-5(2)7(11)8-12-4-6(10)3-9/h5-6,9-10H,3-4H2,1-2H3,(H,8,11)/t6-/m1/s1 |
| InChIKey | XLRGKJZMXIDORC-ZCFIWIBFSA-N |
| XLogP | -0.96 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|