C3H12N2O4 — CID 174978958
3-hydrazinyloxypropane-1,2-diol;hydrate (PubChem CID 174978958) has the molecular formula C3H12N2O4 and a molecular weight of 140.14 g/mol. Its IUPAC name is 3-hydrazinyloxypropane-1,2-diol;hydrate.
| Compound Name | 3-hydrazinyloxypropane-1,2-diol;hydrate |
|---|---|
| PubChem CID | 174978958 |
| Molecular Formula | C3H12N2O4 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 3-hydrazinyloxypropane-1,2-diol;hydrate |
| SMILES | NNOCC(O)CO.O |
| InChI | InChI=1S/C3H10N2O3.H2O/c4-5-8-2-3(7)1-6;/h3,5-7H,1-2,4H2;1H2 |
| InChIKey | VGAJFMUVGBJZHF-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|