C7H13BrO5 — CID 86130589
methyl 2-bromo-3-(2,3-dihydroxypropoxy)propanoate (PubChem CID 86130589) has the molecular formula C7H13BrO5 and a molecular weight of 257.08 g/mol. Its IUPAC name is methyl 2-bromo-3-(2,3-dihydroxypropoxy)propanoate.
| Compound Name | methyl 2-bromo-3-(2,3-dihydroxypropoxy)propanoate |
|---|---|
| PubChem CID | 86130589 |
| Molecular Formula | C7H13BrO5 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | methyl 2-bromo-3-(2,3-dihydroxypropoxy)propanoate |
| SMILES | COC(=O)C(Br)COCC(O)CO |
| InChI | InChI=1S/C7H13BrO5/c1-12-7(11)6(8)4-13-3-5(10)2-9/h5-6,9-10H,2-4H2,1H3 |
| InChIKey | VQCWFIUVGVGAGT-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|