About methyl 2-bromo-4-oxobutanoate
methyl 2-bromo-4-oxobutanoate (PubChem CID 141401171) has the molecular formula C5H7BrO3
and a molecular weight of 195.01 g/mol. Its IUPAC name is methyl 2-bromo-4-oxobutanoate.
Molecular Properties
| Compound Name | methyl 2-bromo-4-oxobutanoate |
| PubChem CID | 141401171 |
| Molecular Formula | C5H7BrO3 |
| Molecular Weight | 195.01 g/mol |
| Exact Mass | 193.96 |
| IUPAC Name | methyl 2-bromo-4-oxobutanoate |
| SMILES | COC(=O)C(Br)CC=O |
| InChI | InChI=1S/C5H7BrO3/c1-9-5(8)4(6)2-3-7/h3-4H,2H2,1H3 |
| InChIKey | CRWWEFSDJTVVPV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.01 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-bromo-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-4-oxobutanoate?
The IUPAC name of methyl 2-bromo-4-oxobutanoate (CID 141401171) is methyl 2-bromo-4-oxobutanoate.
What is the SMILES notation for methyl 2-bromo-4-oxobutanoate?
The canonical SMILES for methyl 2-bromo-4-oxobutanoate is COC(=O)C(Br)CC=O.
What is the InChIKey of methyl 2-bromo-4-oxobutanoate?
The InChIKey is CRWWEFSDJTVVPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrO3/c1-9-5(8)4(6)2-3-7/h3-4H,2H2,1H3.
What are the key properties of methyl 2-bromo-4-oxobutanoate?
methyl 2-bromo-4-oxobutanoate has a molecular weight of 195.01 g/mol, XLogP of 0.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-4-oxobutanoate is sourced from PubChem (CID 141401171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).