C7H15NO6 — CID 87925578
(2S,3R)-2-(2,3-dihydroxypropoxyamino)-3-hydroxybutanoic acid (PubChem CID 87925578) has the molecular formula C7H15NO6 and a molecular weight of 209.20 g/mol. Its IUPAC name is (2S,3R)-2-(2,3-dihydroxypropoxyamino)-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-(2,3-dihydroxypropoxyamino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 87925578 |
| Molecular Formula | C7H15NO6 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (2S,3R)-2-(2,3-dihydroxypropoxyamino)-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NOCC(O)CO)C(=O)O |
| InChI | InChI=1S/C7H15NO6/c1-4(10)6(7(12)13)8-14-3-5(11)2-9/h4-6,8-11H,2-3H2,1H3,(H,12,13)/t4-,5?,6+/m1/s1 |
| InChIKey | JEYFZLZWHULZLQ-QBQQJPCDSA-N |
| XLogP | -2.31 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|