C5H11NO3S — CID 87314479
(2S,3R)-3-hydroxy-2-(sulfanylmethylamino)butanoic acid (PubChem CID 87314479) has the molecular formula C5H11NO3S and a molecular weight of 165.21 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-(sulfanylmethylamino)butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-(sulfanylmethylamino)butanoic acid |
|---|---|
| PubChem CID | 87314479 |
| Molecular Formula | C5H11NO3S |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-(sulfanylmethylamino)butanoic acid |
| SMILES | C[C@@H](O)[C@H](NCS)C(=O)O |
| InChI | InChI=1S/C5H11NO3S/c1-3(7)4(5(8)9)6-2-10/h3-4,6-7,10H,2H2,1H3,(H,8,9)/t3-,4+/m1/s1 |
| InChIKey | KCKCDESJIFQDSV-DMTCNVIQSA-N |
| XLogP | -0.70 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|