C5H9F2NO3 — CID 131206655
(2R)-N-(2,2-difluoroethoxy)-2-hydroxypropanamide (PubChem CID 131206655) has the molecular formula C5H9F2NO3 and a molecular weight of 169.13 g/mol. Its IUPAC name is (2R)-N-(2,2-difluoroethoxy)-2-hydroxypropanamide.
| Compound Name | (2R)-N-(2,2-difluoroethoxy)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 131206655 |
| Molecular Formula | C5H9F2NO3 |
| Molecular Weight | 169.13 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | (2R)-N-(2,2-difluoroethoxy)-2-hydroxypropanamide |
| SMILES | C[C@@H](O)C(=O)NOCC(F)F |
| InChI | InChI=1S/C5H9F2NO3/c1-3(9)5(10)8-11-2-4(6)7/h3-4,9H,2H2,1H3,(H,8,10)/t3-/m1/s1 |
| InChIKey | VBULNWADJRZKGM-GSVOUGTGSA-N |
| XLogP | -0.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.13 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|