C9H18O7 — CID 54375315
(2R,3S,4S,5R)-2-(2,3-dihydroxypropoxy)-3,4,5-trihydroxyhexanal (PubChem CID 54375315) has the molecular formula C9H18O7 and a molecular weight of 238.24 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(2,3-dihydroxypropoxy)-3,4,5-trihydroxyhexanal.
| Compound Name | (2R,3S,4S,5R)-2-(2,3-dihydroxypropoxy)-3,4,5-trihydroxyhexanal |
|---|---|
| PubChem CID | 54375315 |
| Molecular Formula | C9H18O7 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (2R,3S,4S,5R)-2-(2,3-dihydroxypropoxy)-3,4,5-trihydroxyhexanal |
| SMILES | C[C@@H](O)[C@H](O)[C@H](O)[C@H](C=O)OCC(O)CO |
| InChI | InChI=1S/C9H18O7/c1-5(12)8(14)9(15)7(3-11)16-4-6(13)2-10/h3,5-10,12-15H,2,4H2,1H3/t5-,6?,7+,8+,9-/m1/s1 |
| InChIKey | UWBREKPHQFJORF-BXHGQEOQSA-N |
| XLogP | -2.97 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|