C8H15ClO6 — CID 146242612
(2S,3S,4R,5R)-2-(2-chloroethoxy)-3,4,5,6-tetrahydroxyhexanal (PubChem CID 146242612) has the molecular formula C8H15ClO6 and a molecular weight of 242.65 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(2-chloroethoxy)-3,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2S,3S,4R,5R)-2-(2-chloroethoxy)-3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 146242612 |
| Molecular Formula | C8H15ClO6 |
| Molecular Weight | 242.65 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (2S,3S,4R,5R)-2-(2-chloroethoxy)-3,4,5,6-tetrahydroxyhexanal |
| SMILES | O=C[C@@H](OCCCl)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H15ClO6/c9-1-2-15-6(4-11)8(14)7(13)5(12)3-10/h4-8,10,12-14H,1-3H2/t5-,6-,7-,8-/m1/s1 |
| InChIKey | XYYSBUIDUXURPK-WCTZXXKLSA-N |
| XLogP | -2.12 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.65 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|