C7H8Cl4O7 — CID 87399658
2-[3-[carboxy(dichloro)methoxy]-2-hydroxypropoxy]-2,2-dichloroacetic acid (PubChem CID 87399658) has the molecular formula C7H8Cl4O7 and a molecular weight of 345.95 g/mol. Its IUPAC name is 2-[3-[carboxy(dichloro)methoxy]-2-hydroxypropoxy]-2,2-dichloroacetic acid.
| Compound Name | 2-[3-[carboxy(dichloro)methoxy]-2-hydroxypropoxy]-2,2-dichloroacetic acid |
|---|---|
| PubChem CID | 87399658 |
| Molecular Formula | C7H8Cl4O7 |
| Molecular Weight | 345.95 g/mol |
| Exact Mass | 343.90 |
| IUPAC Name | 2-[3-[carboxy(dichloro)methoxy]-2-hydroxypropoxy]-2,2-dichloroacetic acid |
| SMILES | O=C(O)C(Cl)(Cl)OCC(O)COC(Cl)(Cl)C(=O)O |
| InChI | InChI=1S/C7H8Cl4O7/c8-6(9,4(13)14)17-1-3(12)2-18-7(10,11)5(15)16/h3,12H,1-2H2,(H,13,14)(H,15,16) |
| InChIKey | SBDKXZAQFVTLFT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.95 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|