C11H16O7 — CID 161121292
4-[3-(3-carboxyprop-2-enoxy)-2-hydroxypropoxy]but-2-enoic acid (PubChem CID 161121292) has the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. Its IUPAC name is 4-[3-(3-carboxyprop-2-enoxy)-2-hydroxypropoxy]but-2-enoic acid.
| Compound Name | 4-[3-(3-carboxyprop-2-enoxy)-2-hydroxypropoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 161121292 |
| Molecular Formula | C11H16O7 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 4-[3-(3-carboxyprop-2-enoxy)-2-hydroxypropoxy]but-2-enoic acid |
| SMILES | O=C(O)C=CCOCC(O)COCC=CC(=O)O |
| InChI | InChI=1S/C11H16O7/c12-9(7-17-5-1-3-10(13)14)8-18-6-2-4-11(15)16/h1-4,9,12H,5-8H2,(H,13,14)(H,15,16) |
| InChIKey | SSLOVDWRHCVXFL-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|