About 4-hydroperoxybut-2-enoic acid
4-hydroperoxybut-2-enoic acid (PubChem CID 54116733) has the molecular formula C4H6O4
and a molecular weight of 118.09 g/mol. Its IUPAC name is 4-hydroperoxybut-2-enoic acid.
Molecular Properties
| Compound Name | 4-hydroperoxybut-2-enoic acid |
| PubChem CID | 54116733 |
| Molecular Formula | C4H6O4 |
| Molecular Weight | 118.09 g/mol |
| Exact Mass | 118.03 |
| IUPAC Name | 4-hydroperoxybut-2-enoic acid |
| SMILES | O=C(O)C=CCOO |
| InChI | InChI=1S/C4H6O4/c5-4(6)2-1-3-8-7/h1-2,7H,3H2,(H,5,6) |
| InChIKey | NKVQBUXLNILTGI-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.09 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroperoxybut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroperoxybut-2-enoic acid?
The IUPAC name of 4-hydroperoxybut-2-enoic acid (CID 54116733) is 4-hydroperoxybut-2-enoic acid.
What is the SMILES notation for 4-hydroperoxybut-2-enoic acid?
The canonical SMILES for 4-hydroperoxybut-2-enoic acid is O=C(O)C=CCOO.
What is the InChIKey of 4-hydroperoxybut-2-enoic acid?
The InChIKey is NKVQBUXLNILTGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4/c5-4(6)2-1-3-8-7/h1-2,7H,3H2,(H,5,6).
What are the key properties of 4-hydroperoxybut-2-enoic acid?
4-hydroperoxybut-2-enoic acid has a molecular weight of 118.09 g/mol, XLogP of 0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroperoxybut-2-enoic acid is sourced from PubChem (CID 54116733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).