C6H13O8P — CID 174675180
[1-(2,3-dihydroxypropoxy)-1-hydroxy-2-oxopropyl]phosphonic acid (PubChem CID 174675180) has the molecular formula C6H13O8P and a molecular weight of 244.14 g/mol. Its IUPAC name is [1-(2,3-dihydroxypropoxy)-1-hydroxy-2-oxopropyl]phosphonic acid.
| Compound Name | [1-(2,3-dihydroxypropoxy)-1-hydroxy-2-oxopropyl]phosphonic acid |
|---|---|
| PubChem CID | 174675180 |
| Molecular Formula | C6H13O8P |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | [1-(2,3-dihydroxypropoxy)-1-hydroxy-2-oxopropyl]phosphonic acid |
| SMILES | CC(=O)C(O)(OCC(O)CO)P(=O)(O)O |
| InChI | InChI=1S/C6H13O8P/c1-4(8)6(10,15(11,12)13)14-3-5(9)2-7/h5,7,9-10H,2-3H2,1H3,(H2,11,12,13) |
| InChIKey | SORSAYSNFQIPGJ-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|