C17H36O — CID 162765220
ethane;(3Z,5E)-3-methyl-5-propan-2-yloxyhepta-1,3,5-triene (PubChem CID 162765220) has the molecular formula C17H36O and a molecular weight of 256.47 g/mol. Its IUPAC name is ethane;(3Z,5E)-3-methyl-5-propan-2-yloxyhepta-1,3,5-triene.
| Compound Name | ethane;(3Z,5E)-3-methyl-5-propan-2-yloxyhepta-1,3,5-triene |
|---|---|
| PubChem CID | 162765220 |
| Molecular Formula | C17H36O |
| Molecular Weight | 256.47 g/mol |
| Exact Mass | 256.28 |
| IUPAC Name | ethane;(3Z,5E)-3-methyl-5-propan-2-yloxyhepta-1,3,5-triene |
| SMILES | C=C/C(C)=C\C(=C/C)OC(C)C.CC.CC.CC |
| InChI | InChI=1S/C11H18O.3C2H6/c1-6-10(5)8-11(7-2)12-9(3)4;3*1-2/h6-9H,1H2,2-5H3;3*1-2H3/b10-8-,11-7+;;; |
| InChIKey | DROPQAJJFPSKFH-ZIHGXDBZSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.47 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|