C10H19N — CID 143646233
(3Z)-N,4-dimethylhexa-1,3,5-trien-2-amine;ethane (PubChem CID 143646233) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (3Z)-N,4-dimethylhexa-1,3,5-trien-2-amine;ethane.
| Compound Name | (3Z)-N,4-dimethylhexa-1,3,5-trien-2-amine;ethane |
|---|---|
| PubChem CID | 143646233 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (3Z)-N,4-dimethylhexa-1,3,5-trien-2-amine;ethane |
| SMILES | C=C/C(C)=C\C(=C)NC.CC |
| InChI | InChI=1S/C8H13N.C2H6/c1-5-7(2)6-8(3)9-4;1-2/h5-6,9H,1,3H2,2,4H3;1-2H3/b7-6-; |
| InChIKey | QFIBRBJIMRPHET-NAFXZHHSSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|