C12H20 — CID 142052871
ethane;[(3Z)-4-methylhexa-1,3,5-trien-2-yl]cyclopropane (PubChem CID 142052871) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is ethane;[(3Z)-4-methylhexa-1,3,5-trien-2-yl]cyclopropane.
| Compound Name | ethane;[(3Z)-4-methylhexa-1,3,5-trien-2-yl]cyclopropane |
|---|---|
| PubChem CID | 142052871 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | ethane;[(3Z)-4-methylhexa-1,3,5-trien-2-yl]cyclopropane |
| SMILES | C=C/C(C)=C\C(=C)C1CC1.CC |
| InChI | InChI=1S/C10H14.C2H6/c1-4-8(2)7-9(3)10-5-6-10;1-2/h4,7,10H,1,3,5-6H2,2H3;1-2H3/b8-7-; |
| InChIKey | KZHGOCFMSBIUEH-CFYXSCKTSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|