About [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane
[(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane (PubChem CID 143871656) has the molecular formula C9H14
and a molecular weight of 122.21 g/mol. Its IUPAC name is [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane.
Molecular Properties
| Compound Name | [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane |
| PubChem CID | 143871656 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane |
| SMILES | C=C(C)/C(=C\C)C1CC1 |
| InChI | InChI=1S/C9H14/c1-4-9(7(2)3)8-5-6-8/h4,8H,2,5-6H2,1,3H3/b9-4+ |
| InChIKey | ZMNVPYHKRDVGHS-RUDMXATFSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane?
The IUPAC name of [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane (CID 143871656) is [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane.
What is the SMILES notation for [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane?
The canonical SMILES for [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane is C=C(C)/C(=C\C)C1CC1.
What is the InChIKey of [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane?
The InChIKey is ZMNVPYHKRDVGHS-RUDMXATFSA-N. The full InChI is InChI=1S/C9H14/c1-4-9(7(2)3)8-5-6-8/h4,8H,2,5-6H2,1,3H3/b9-4+.
What are the key properties of [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane?
[(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane has a molecular weight of 122.21 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-2-methylpenta-1,3-dien-3-yl]cyclopropane is sourced from PubChem (CID 143871656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).