C15H24F2 — CID 143901343
1-[(2Z,4Z)-4,5-difluorohexa-2,4-dien-3-yl]-4-propylcyclohexane (PubChem CID 143901343) has the molecular formula C15H24F2 and a molecular weight of 242.35 g/mol. Its IUPAC name is 1-[(2Z,4Z)-4,5-difluorohexa-2,4-dien-3-yl]-4-propylcyclohexane.
| Compound Name | 1-[(2Z,4Z)-4,5-difluorohexa-2,4-dien-3-yl]-4-propylcyclohexane |
|---|---|
| PubChem CID | 143901343 |
| Molecular Formula | C15H24F2 |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-[(2Z,4Z)-4,5-difluorohexa-2,4-dien-3-yl]-4-propylcyclohexane |
| SMILES | C/C=C(C(\F)=C(/C)F)/C1CCC(CCC)CC1 |
| InChI | InChI=1S/C15H24F2/c1-4-6-12-7-9-13(10-8-12)14(5-2)15(17)11(3)16/h5,12-13H,4,6-10H2,1-3H3/b14-5-,15-11- |
| InChIKey | OJJUDBOVVORTDS-RJSUYGKXSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|