C14H26F2Si — CID 54125156
[1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-trimethylsilane (PubChem CID 54125156) has the molecular formula C14H26F2Si and a molecular weight of 260.44 g/mol. Its IUPAC name is [1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-trimethylsilane.
| Compound Name | [1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-trimethylsilane |
|---|---|
| PubChem CID | 54125156 |
| Molecular Formula | C14H26F2Si |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | [1,2-difluoro-2-(4-propylcyclohexyl)ethenyl]-trimethylsilane |
| SMILES | CCCC1CCC(C(F)=C(F)[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C14H26F2Si/c1-5-6-11-7-9-12(10-8-11)13(15)14(16)17(2,3)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | NQKVPCIJUBSDIS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|