C22H30F2O — CID 88953250
4-[(3Z,5Z)-5-(4-ethenylcyclohexyl)-3,4-difluorohepta-1,3,5-trien-2-yl]cyclohexane-1-carbaldehyde (PubChem CID 88953250) has the molecular formula C22H30F2O and a molecular weight of 348.48 g/mol. Its IUPAC name is 4-[(3Z,5Z)-5-(4-ethenylcyclohexyl)-3,4-difluorohepta-1,3,5-trien-2-yl]cyclohexane-1-carbaldehyde.
| Compound Name | 4-[(3Z,5Z)-5-(4-ethenylcyclohexyl)-3,4-difluorohepta-1,3,5-trien-2-yl]cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 88953250 |
| Molecular Formula | C22H30F2O |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 4-[(3Z,5Z)-5-(4-ethenylcyclohexyl)-3,4-difluorohepta-1,3,5-trien-2-yl]cyclohexane-1-carbaldehyde |
| SMILES | C=CC1CCC(C(=C/C)/C(F)=C(/F)C(=C)C2CCC(C=O)CC2)CC1 |
| InChI | InChI=1S/C22H30F2O/c1-4-16-6-12-19(13-7-16)20(5-2)22(24)21(23)15(3)18-10-8-17(14-25)9-11-18/h4-5,14,16-19H,1,3,6-13H2,2H3/b20-5-,22-21- |
| InChIKey | GAZODKQKLDKACI-KVJIDTETSA-N |
| XLogP | 6.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|