C30H34F4O — CID 88953333
1-[4-[(4Z,6Z)-6-(4-ethenylcyclohexyl)-4,5-difluoroocta-4,6-dienyl]phenyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 88953333) has the molecular formula C30H34F4O and a molecular weight of 486.59 g/mol. Its IUPAC name is 1-[4-[(4Z,6Z)-6-(4-ethenylcyclohexyl)-4,5-difluoroocta-4,6-dienyl]phenyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[4-[(4Z,6Z)-6-(4-ethenylcyclohexyl)-4,5-difluoroocta-4,6-dienyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 88953333 |
| Molecular Formula | C30H34F4O |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 1-[4-[(4Z,6Z)-6-(4-ethenylcyclohexyl)-4,5-difluoroocta-4,6-dienyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | C=CC1CCC(C(=C/C)/C(F)=C(/F)CCCc2ccc(-c3ccc(OCC)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C30H34F4O/c1-4-20-10-14-22(15-11-20)24(5-2)28(32)26(31)9-7-8-21-12-16-23(17-13-21)25-18-19-27(35-6-3)30(34)29(25)33/h4-5,12-13,16-20,22H,1,6-11,14-15H2,2-3H3/b24-5-,28-26- |
| InChIKey | XUBAISKLUIYMCS-RWXPECSJSA-N |
| XLogP | 9.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|