C24H36 — CID 145066008
1-ethenyl-4-[(E)-2-[4-[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]cyclohexyl]ethenyl]cyclohexane (PubChem CID 145066008) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is 1-ethenyl-4-[(E)-2-[4-[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]cyclohexyl]ethenyl]cyclohexane.
| Compound Name | 1-ethenyl-4-[(E)-2-[4-[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]cyclohexyl]ethenyl]cyclohexane |
|---|---|
| PubChem CID | 145066008 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 1-ethenyl-4-[(E)-2-[4-[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]cyclohexyl]ethenyl]cyclohexane |
| SMILES | C=CC1CCC(/C=C/C2CCC(C(/C=C\C(=C)C)=C/C)CC2)CC1 |
| InChI | InChI=1S/C24H36/c1-5-20-8-10-21(11-9-20)12-13-22-14-17-24(18-15-22)23(6-2)16-7-19(3)4/h5-7,12-13,16,20-22,24H,1,3,8-11,14-15,17-18H2,2,4H3/b13-12+,16-7-,23-6+ |
| InChIKey | HMUFORWRAFGXAV-UFNYEQGSSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|