C23H32 — CID 163691247
1-[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-[(3E)-4-methyl-5-methylidenehepta-1,3,6-trien-2-yl]cyclohexane (PubChem CID 163691247) has the molecular formula C23H32 and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-[(3E)-4-methyl-5-methylidenehepta-1,3,6-trien-2-yl]cyclohexane.
| Compound Name | 1-[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-[(3E)-4-methyl-5-methylidenehepta-1,3,6-trien-2-yl]cyclohexane |
|---|---|
| PubChem CID | 163691247 |
| Molecular Formula | C23H32 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 1-[(2Z,4Z)-6-methylhepta-2,4,6-trien-3-yl]-4-[(3E)-4-methyl-5-methylidenehepta-1,3,6-trien-2-yl]cyclohexane |
| SMILES | C=CC(=C)/C(C)=C/C(=C)C1CCC(C(/C=C\C(=C)C)=C/C)CC1 |
| InChI | InChI=1S/C23H32/c1-8-18(5)19(6)16-20(7)22-12-14-23(15-13-22)21(9-2)11-10-17(3)4/h8-11,16,22-23H,1,3,5,7,12-15H2,2,4,6H3/b11-10-,19-16+,21-9+ |
| InChIKey | JTDFFKLQKGJQNX-RJTUVDCZSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|