C16H31N — CID 142942953
ethane;4-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]piperidine (PubChem CID 142942953) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is ethane;4-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]piperidine.
| Compound Name | ethane;4-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]piperidine |
|---|---|
| PubChem CID | 142942953 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | ethane;4-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]piperidine |
| SMILES | C=C/C=C\C(=C/C)C1CCNCC1.CC.CC |
| InChI | InChI=1S/C12H19N.2C2H6/c1-3-5-6-11(4-2)12-7-9-13-10-8-12;2*1-2/h3-6,12-13H,1,7-10H2,2H3;2*1-2H3/b6-5-,11-4+;; |
| InChIKey | RSZBVRPVACPPLA-IPVZZMEGSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|