C10H16N2 — CID 142494932
N-[(1E,3Z)-2-pyrrolidin-3-ylpenta-1,3-dienyl]methanimine (PubChem CID 142494932) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-[(1E,3Z)-2-pyrrolidin-3-ylpenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-2-pyrrolidin-3-ylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 142494932 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-[(1E,3Z)-2-pyrrolidin-3-ylpenta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C/C)C1CCNC1 |
| InChI | InChI=1S/C10H16N2/c1-3-4-9(7-11-2)10-5-6-12-8-10/h3-4,7,10,12H,2,5-6,8H2,1H3/b4-3-,9-7+ |
| InChIKey | PGCGQUXJKCMLBZ-GAWLIRPZSA-N |
| XLogP | 1.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|