C11H14N2 — CID 156818782
(3E,5Z)-4-(azetidin-3-yl)-2-methylidenehepta-3,5-dienenitrile (PubChem CID 156818782) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (3E,5Z)-4-(azetidin-3-yl)-2-methylidenehepta-3,5-dienenitrile.
| Compound Name | (3E,5Z)-4-(azetidin-3-yl)-2-methylidenehepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 156818782 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (3E,5Z)-4-(azetidin-3-yl)-2-methylidenehepta-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C(\C=C/C)C1CNC1 |
| InChI | InChI=1S/C11H14N2/c1-3-4-10(5-9(2)6-12)11-7-13-8-11/h3-5,11,13H,2,7-8H2,1H3/b4-3-,10-5+ |
| InChIKey | YXAFALXOQSFXFI-DXWLQBKVSA-N |
| XLogP | 1.79 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|