C11H19N3 — CID 163401538
(Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine (PubChem CID 163401538) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine.
| Compound Name | (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine |
|---|---|
| PubChem CID | 163401538 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine |
| SMILES | C=N/C=C(\C=N\CC)C1CCNCC1 |
| InChI | InChI=1S/C11H19N3/c1-3-13-9-11(8-12-2)10-4-6-14-7-5-10/h8-10,14H,2-7H2,1H3/b11-8+,13-9+ |
| InChIKey | TXOFQKZIPZZBHO-BLTLMDCKSA-N |
| XLogP | 1.66 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|