About (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine
(Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine (PubChem CID 163401538) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine.
Molecular Properties
| Compound Name | (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine |
| PubChem CID | 163401538 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine |
| SMILES | C=N/C=C(\C=N\CC)C1CCNCC1 |
| InChI | InChI=1S/C11H19N3/c1-3-13-9-11(8-12-2)10-4-6-14-7-5-10/h8-10,14H,2-7H2,1H3/b11-8+,13-9+ |
| InChIKey | TXOFQKZIPZZBHO-BLTLMDCKSA-N |
| XLogP | 1.66 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine?
The IUPAC name of (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine (CID 163401538) is (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine.
What is the SMILES notation for (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine?
The canonical SMILES for (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine is C=N/C=C(\C=N\CC)C1CCNCC1.
What is the InChIKey of (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine?
The InChIKey is TXOFQKZIPZZBHO-BLTLMDCKSA-N. The full InChI is InChI=1S/C11H19N3/c1-3-13-9-11(8-12-2)10-4-6-14-7-5-10/h8-10,14H,2-7H2,1H3/b11-8+,13-9+.
What are the key properties of (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine?
(Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine has a molecular weight of 193.29 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethyl-N'-methylidene-2-piperidin-4-ylprop-2-ene-1,3-diimine is sourced from PubChem (CID 163401538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).