C13H23NO — CID 154930709
3-[(3E,5Z)-7-methoxyocta-3,5-dien-4-yl]pyrrolidine (PubChem CID 154930709) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 3-[(3E,5Z)-7-methoxyocta-3,5-dien-4-yl]pyrrolidine.
| Compound Name | 3-[(3E,5Z)-7-methoxyocta-3,5-dien-4-yl]pyrrolidine |
|---|---|
| PubChem CID | 154930709 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 3-[(3E,5Z)-7-methoxyocta-3,5-dien-4-yl]pyrrolidine |
| SMILES | CC/C=C(\C=C/C(C)OC)C1CCNC1 |
| InChI | InChI=1S/C13H23NO/c1-4-5-12(7-6-11(2)15-3)13-8-9-14-10-13/h5-7,11,13-14H,4,8-10H2,1-3H3/b7-6-,12-5+ |
| InChIKey | IMYJATWPNWUJFO-BZNMCICSSA-N |
| XLogP | 2.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|