C12H20N2 — CID 142139228
(2E)-N-(1-piperidin-4-ylethenyl)penta-2,4-dien-2-amine (PubChem CID 142139228) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (2E)-N-(1-piperidin-4-ylethenyl)penta-2,4-dien-2-amine.
| Compound Name | (2E)-N-(1-piperidin-4-ylethenyl)penta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 142139228 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (2E)-N-(1-piperidin-4-ylethenyl)penta-2,4-dien-2-amine |
| SMILES | C=C/C=C(\C)NC(=C)C1CCNCC1 |
| InChI | InChI=1S/C12H20N2/c1-4-5-10(2)14-11(3)12-6-8-13-9-7-12/h4-5,12-14H,1,3,6-9H2,2H3/b10-5+ |
| InChIKey | FDJFHXRJXHJAPE-BJMVGYQFSA-N |
| XLogP | 2.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|