C12H17N — CID 143745515
(3E,5Z)-N-[(2E)-penta-2,4-dien-2-yl]hepta-1,3,5-trien-3-amine (PubChem CID 143745515) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is (3E,5Z)-N-[(2E)-penta-2,4-dien-2-yl]hepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-N-[(2E)-penta-2,4-dien-2-yl]hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 143745515 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (3E,5Z)-N-[(2E)-penta-2,4-dien-2-yl]hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(\C)N/C(C=C)=C/C=C\C |
| InChI | InChI=1S/C12H17N/c1-5-8-10-12(7-3)13-11(4)9-6-2/h5-10,13H,2-3H2,1,4H3/b8-5-,11-9+,12-10+ |
| InChIKey | BGWODBMLYSKRTA-AMVUOHPKSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|