C11H17N — CID 126490180
(3E,5Z)-N-but-3-en-2-ylhepta-1,3,5-trien-3-amine (PubChem CID 126490180) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (3E,5Z)-N-but-3-en-2-ylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-N-but-3-en-2-ylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 126490180 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (3E,5Z)-N-but-3-en-2-ylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C=C/C)NC(C)C=C |
| InChI | InChI=1S/C11H17N/c1-5-8-9-11(7-3)12-10(4)6-2/h5-10,12H,2-3H2,1,4H3/b8-5-,11-9+ |
| InChIKey | IWCMYILWPYJKLI-TWGJSUAUSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|