C16H23N — CID 143052438
(3E)-3-ethylidene-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methylhexa-1,4-dien-2-amine (PubChem CID 143052438) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (3E)-3-ethylidene-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methylhexa-1,4-dien-2-amine.
| Compound Name | (3E)-3-ethylidene-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methylhexa-1,4-dien-2-amine |
|---|---|
| PubChem CID | 143052438 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (3E)-3-ethylidene-N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methylhexa-1,4-dien-2-amine |
| SMILES | C=C/C(=C\C=C/C)NC(=C)/C(C=C(C)C)=C/C |
| InChI | InChI=1S/C16H23N/c1-7-10-11-16(9-3)17-14(6)15(8-2)12-13(4)5/h7-12,17H,3,6H2,1-2,4-5H3/b10-7-,15-8+,16-11+ |
| InChIKey | MFJKLTSPVIKIGN-OAYFWEIUSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|