C19H33N2+ — CID 20981557
1-[1-(azocan-5-yl)penta-2,4-dienylidene]azocan-1-ium (PubChem CID 20981557) has the molecular formula C19H33N2+ and a molecular weight of 289.49 g/mol. Its IUPAC name is 1-[1-(azocan-5-yl)penta-2,4-dienylidene]azocan-1-ium.
| Compound Name | 1-[1-(azocan-5-yl)penta-2,4-dienylidene]azocan-1-ium |
|---|---|
| PubChem CID | 20981557 |
| Molecular Formula | C19H33N2+ |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | 1-[1-(azocan-5-yl)penta-2,4-dienylidene]azocan-1-ium |
| SMILES | C=CC=CC(C1CCCNCCC1)=[N+]1CCCCCCC1 |
| InChI | InChI=1S/C19H33N2/c1-2-3-13-19(18-11-9-14-20-15-10-12-18)21-16-7-5-4-6-8-17-21/h2-3,13,18,20H,1,4-12,14-17H2/q+1 |
| InChIKey | MNUXJTIBGLOMEM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|