About 1-cyclopropylethenethiol
1-cyclopropylethenethiol (PubChem CID 143525795) has the molecular formula C5H8S
and a molecular weight of 100.19 g/mol. Its IUPAC name is 1-cyclopropylethenethiol.
Molecular Properties
| Compound Name | 1-cyclopropylethenethiol |
| PubChem CID | 143525795 |
| Molecular Formula | C5H8S |
| Molecular Weight | 100.19 g/mol |
| Exact Mass | 100.03 |
| IUPAC Name | 1-cyclopropylethenethiol |
| SMILES | C=C(S)C1CC1 |
| InChI | InChI=1S/C5H8S/c1-4(6)5-2-3-5/h5-6H,1-3H2 |
| InChIKey | RXXZLYVECUNNLX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropylethenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylethenethiol?
The IUPAC name of 1-cyclopropylethenethiol (CID 143525795) is 1-cyclopropylethenethiol.
What is the SMILES notation for 1-cyclopropylethenethiol?
The canonical SMILES for 1-cyclopropylethenethiol is C=C(S)C1CC1.
What is the InChIKey of 1-cyclopropylethenethiol?
The InChIKey is RXXZLYVECUNNLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8S/c1-4(6)5-2-3-5/h5-6H,1-3H2.
What are the key properties of 1-cyclopropylethenethiol?
1-cyclopropylethenethiol has a molecular weight of 100.19 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylethenethiol is sourced from PubChem (CID 143525795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).