C14H24 — CID 154187048
2-(1-cyclopropylethenyl)-1,1,3,3-tetramethylcyclopentane (PubChem CID 154187048) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 2-(1-cyclopropylethenyl)-1,1,3,3-tetramethylcyclopentane.
| Compound Name | 2-(1-cyclopropylethenyl)-1,1,3,3-tetramethylcyclopentane |
|---|---|
| PubChem CID | 154187048 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 2-(1-cyclopropylethenyl)-1,1,3,3-tetramethylcyclopentane |
| SMILES | C=C(C1CC1)C1C(C)(C)CCC1(C)C |
| InChI | InChI=1S/C14H24/c1-10(11-6-7-11)12-13(2,3)8-9-14(12,4)5/h11-12H,1,6-9H2,2-5H3 |
| InChIKey | LQSJWHSGPSNLQW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|