C15H23I — CID 90435928
1-[(3Z,5Z)-6-iodo-2-methylhepta-1,3,5-trien-3-yl]-4-methylcyclohexane (PubChem CID 90435928) has the molecular formula C15H23I and a molecular weight of 330.25 g/mol. Its IUPAC name is 1-[(3Z,5Z)-6-iodo-2-methylhepta-1,3,5-trien-3-yl]-4-methylcyclohexane.
| Compound Name | 1-[(3Z,5Z)-6-iodo-2-methylhepta-1,3,5-trien-3-yl]-4-methylcyclohexane |
|---|---|
| PubChem CID | 90435928 |
| Molecular Formula | C15H23I |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-[(3Z,5Z)-6-iodo-2-methylhepta-1,3,5-trien-3-yl]-4-methylcyclohexane |
| SMILES | C=C(C)/C(=C\C=C(\C)I)C1CCC(C)CC1 |
| InChI | InChI=1S/C15H23I/c1-11(2)15(10-7-13(4)16)14-8-5-12(3)6-9-14/h7,10,12,14H,1,5-6,8-9H2,2-4H3/b13-7-,15-10+ |
| InChIKey | HJLVNJUFQODDJM-IFECZTAMSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|