C21H36 — CID 145066119
1-methyl-4-[[4-[(2E)-5-methylhexa-2,4-dien-2-yl]cyclohexyl]methyl]cyclohexane (PubChem CID 145066119) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is 1-methyl-4-[[4-[(2E)-5-methylhexa-2,4-dien-2-yl]cyclohexyl]methyl]cyclohexane.
| Compound Name | 1-methyl-4-[[4-[(2E)-5-methylhexa-2,4-dien-2-yl]cyclohexyl]methyl]cyclohexane |
|---|---|
| PubChem CID | 145066119 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 1-methyl-4-[[4-[(2E)-5-methylhexa-2,4-dien-2-yl]cyclohexyl]methyl]cyclohexane |
| SMILES | CC(C)=C/C=C(\C)C1CCC(CC2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C21H36/c1-16(2)5-8-18(4)21-13-11-20(12-14-21)15-19-9-6-17(3)7-10-19/h5,8,17,19-21H,6-7,9-15H2,1-4H3/b18-8+ |
| InChIKey | BGUWJWBXHMMRSE-QGMBQPNBSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|