C24H42 — CID 140550481
1-[1,1-bis(4-methylcyclohexyl)prop-1-en-2-yl]-4-methylcyclohexane (PubChem CID 140550481) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is 1-[1,1-bis(4-methylcyclohexyl)prop-1-en-2-yl]-4-methylcyclohexane.
| Compound Name | 1-[1,1-bis(4-methylcyclohexyl)prop-1-en-2-yl]-4-methylcyclohexane |
|---|---|
| PubChem CID | 140550481 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | 1-[1,1-bis(4-methylcyclohexyl)prop-1-en-2-yl]-4-methylcyclohexane |
| SMILES | CC(=C(C1CCC(C)CC1)C1CCC(C)CC1)C1CCC(C)CC1 |
| InChI | InChI=1S/C24H42/c1-17-5-11-21(12-6-17)20(4)24(22-13-7-18(2)8-14-22)23-15-9-19(3)10-16-23/h17-19,21-23H,5-16H2,1-4H3 |
| InChIKey | VPESUKDYNLVPGK-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|